EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22O3 |
| Net Charge | 0 |
| Average Mass | 310.393 |
| Monoisotopic Mass | 310.15689 |
| SMILES | COc1ccc(C(=O)CC(=O)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C20H22O3/c1-20(2,3)16-9-5-14(6-10-16)18(21)13-19(22)15-7-11-17(23-4)12-8-15/h5-12H,13H2,1-4H3 |
| InChIKey | XNEFYCZVKIDDMS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| avobenzone (CHEBI:134751) has role antineoplastic agent (CHEBI:35610) |
| avobenzone (CHEBI:134751) is a dihydrochalcones (CHEBI:71230) |
| INN | Source |
|---|---|
| avobenzona | WHO MedNet |
| Synonyms | Source |
|---|---|
| Avobenzone | ChEMBL |
| butylmethoxydibenzoylmethane | DrugCentral |
| Butyl methoxydibenzoylmethane | ChEMBL |
| Escalol 517 | ChEMBL |
| Eusolex 9020 | ChEMBL |
| Neoheliopan 357 | ChEMBL |
| Brand Names | Source |
|---|---|
| Avobenzone component of anthelios sx | ChEMBL |
| Avobenzone component of capital soleil | ChEMBL |
| Avobenzone component of shade uvaguard | ChEMBL |
| Parsol 1789 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 4242 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:70356-09-1 | DrugCentral |
| Citations |
|---|