EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H26O3 |
| Net Charge | 0 |
| Average Mass | 290.403 |
| Monoisotopic Mass | 290.18819 |
| SMILES | CCCCC(CC)COC(=O)C=Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C18H26O3/c1-4-6-7-15(5-2)14-21-18(19)13-10-16-8-11-17(20-3)12-9-16/h8-13,15H,4-7,14H2,1-3H3 |
| InChIKey | YBGZDTIWKVFICR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| octinoxate (CHEBI:134750) has role antineoplastic agent (CHEBI:35610) |
| octinoxate (CHEBI:134750) is a cinnamate ester (CHEBI:36087) |
| INN | Source |
|---|---|
| octinoxato | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2-ethylhexyl p-methoxycinnamate | ChEMBL |
| 2-ethylhexyl-p-methoxycinnamate | ChEMBL |
| Escalol 557 | ChEMBL |
| Escalol 557nb | ChEMBL |
| Escalol 557t | ChEMBL |
| ethylhexyl methoxycinnamate | DrugCentral |
| Brand Name | Source |
|---|---|
| Octinoxate component of shade uvaguard | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 4236 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:5466-77-3 | DrugCentral |
| Citations |
|---|