EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H26NO3 |
| Net Charge | +1 |
| Average Mass | 304.410 |
| Monoisotopic Mass | 304.19072 |
| SMILES | [H][C@]1(OC(=O)[C@@H](CO)c2ccccc2)C[C@]2([H])CC[C@]([H])(C1)[N+]2(C)C |
| InChI | InChI=1S/C18H26NO3/c1-19(2)14-8-9-15(19)11-16(10-14)22-18(21)17(12-20)13-6-4-3-5-7-13/h3-7,14-17,20H,8-12H2,1-2H3/q+1/t14-,15+,16-,17-/m0/s1 |
| InChIKey | PIPAJLPNWZMYQA-YVSFHVDLSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methylatropine (CHEBI:134749) is a tropane alkaloid (CHEBI:37332) |
| Synonyms | Source |
|---|---|
| atropine methobromide | DrugCentral |
| atropine methonitrate | DrugCentral |
| methylatropine nitrate | DrugCentral |
| methylatropinium | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 4660 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:31610-87-4 | DrugCentral |