EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H32N2 |
| Net Charge | 0 |
| Average Mass | 288.479 |
| Monoisotopic Mass | 288.25655 |
| SMILES | [H][C@]12CN(CC3CC3)C[C@]([H])(CN(CC3CC3)C1)C21CCCC1 |
| InChI | InChI=1S/C19H32N2/c1-2-8-19(7-1)17-11-20(9-15-3-4-15)12-18(19)14-21(13-17)10-16-5-6-16/h15-18H,1-14H2/t17-,18+ |
| InChIKey | CTIRHWCPXYGDGF-HDICACEKSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | potassium channel blocker An agent that inhibits cell membrane glycoproteins that are selectively permeable to potassium ions. |
| Application: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tedisamil (CHEBI:134747) has role anti-arrhythmia drug (CHEBI:38070) |
| tedisamil (CHEBI:134747) has role potassium channel blocker (CHEBI:50509) |
| tedisamil (CHEBI:134747) is a azaspiro compound (CHEBI:35624) |
| tedisamil (CHEBI:134747) is a cyclopentanes (CHEBI:23493) |
| tedisamil (CHEBI:134747) is a cyclopropanes (CHEBI:51454) |
| tedisamil (CHEBI:134747) is a diazabicyclononane (CHEBI:18945) |
| IUPAC Name |
|---|
| (1s,5s)-3,7-bis(cyclopropylmethyl)-3,7-diazaspiro[bicyclo[3.3.1]nonane-9,1'-cyclopentane] |
| INNs | Source |
|---|---|
| tedisamil | WHO MedNet |
| tedisamil | WHO MedNet |
| tédisamil | WHO MedNet |
| tedisamilum | WHO MedNet |
| Synonyms | Source |
|---|---|
| KC 8857 | ChemIDplus |
| KC-8857 | DrugCentral |
| KC8857 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Pulzium | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:90961-53-8 | ChemIDplus |
| Citations |
|---|