EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H38O6 |
| Net Charge | 0 |
| Average Mass | 530.661 |
| Monoisotopic Mass | 530.26684 |
| SMILES | O=C(CCCc1ccccc1)OCC(COC(=O)CCCc1ccccc1)OC(=O)CCCc1ccccc1 |
| InChI | InChI=1S/C33H38O6/c34-31(22-10-19-27-13-4-1-5-14-27)37-25-30(39-33(36)24-12-21-29-17-8-3-9-18-29)26-38-32(35)23-11-20-28-15-6-2-7-16-28/h1-9,13-18,30H,10-12,19-26H2 |
| InChIKey | ZSDBFLMJVAGKOU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glycerol phenylbutyrate (CHEBI:134745) has role antiparkinson drug (CHEBI:48407) |
| glycerol phenylbutyrate (CHEBI:134745) is a triglyceride (CHEBI:17855) |
| INNs | Source |
|---|---|
| fenilbutirato de glicerol | WHO MedNet |
| phenylbutyrate de glycerol | WHO MedNet |
| Synonyms | Source |
|---|---|
| Glycerol phenylbutyrate | ChEMBL |
| HPN-100 | DrugCentral |
| HPN100 | ChEMBL |
| ravicti | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 4745 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:611168-24-2 | DrugCentral |