EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H36N4O8 |
| Net Charge | 0 |
| Average Mass | 472.539 |
| Monoisotopic Mass | 472.25331 |
| SMILES | [H][C@@]1([C@H](OC)[C@H](O)COC(=O)CCCCCCC)OC(C(=O)O)=C[C@H](NC(=N)N)[C@H]1NC(C)=O |
| InChI | InChI=1S/C21H36N4O8/c1-4-5-6-7-8-9-16(28)32-11-14(27)18(31-3)19-17(24-12(2)26)13(25-21(22)23)10-15(33-19)20(29)30/h10,13-14,17-19,27H,4-9,11H2,1-3H3,(H,24,26)(H,29,30)(H4,22,23,25)/t13-,14+,17+,18+,19+/m0/s1 |
| InChIKey | UKTIJASCFRNWCB-RMIBSVFLSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | anti-asthmatic agent Any compound that has anti-asthmatic effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| laninamivir octanoate hydrate (CHEBI:134741) has role anti-asthmatic agent (CHEBI:65023) |
| laninamivir octanoate hydrate (CHEBI:134741) has role antiviral agent (CHEBI:22587) |
| laninamivir octanoate hydrate (CHEBI:134741) is a fatty acid ester (CHEBI:35748) |
| Synonyms | Source |
|---|---|
| CS-8958 | DrugCentral |
| inavir | DrugCentral |
| laninamivir octanoate | DrugCentral |
| laninamivir octanoate | ChEMBL |
| Laninamivir octanoic acid ester | ChEMBL |
| R-118958 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 4822 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:203120-46-1 | DrugCentral |
| Citations |
|---|