EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H7NO3.Na |
| Net Charge | 0 |
| Average Mass | 331.055 |
| Monoisotopic Mass | 330.93849 |
| SMILES | O=C([O-])CNC(=O)c1ccccc1[131I].[Na+] |
| InChI | InChI=1S/C9H8INO3.Na/c10-7-4-2-1-3-6(7)9(14)11-5-8(12)13;/h1-4H,5H2,(H,11,14)(H,12,13);/q;+1/p-1/i10+4; |
| InChIKey | XYITYKDGJLHYPW-UDYUCQKZSA-M |
| Roles Classification |
|---|
| Applications: | radiopharmaceutical Any pharmaceutical compound containing a radioisotope. radioopaque medium A substance having the property of absorbing, and therefore being opaque to, electromagnetic radiation, particularly X-rays. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium 2-(131I)iodohippurate (CHEBI:134740) has functional parent N-benzoylglycine (CHEBI:18089) |
| sodium 2-(131I)iodohippurate (CHEBI:134740) has role radiopharmaceutical (CHEBI:35232) |
| sodium 2-(131I)iodohippurate (CHEBI:134740) is a isotopically modified compound (CHEBI:139358) |
| sodium 2-(131I)iodohippurate (CHEBI:134740) is a organic sodium salt (CHEBI:38700) |
| sodium 2-(131I)iodohippurate (CHEBI:134740) is a sodium 2-iodohippurate (CHEBI:140411) |
| IUPAC Name |
|---|
| sodium [2-(131I)iodobenzamido]acetate |
| Synonyms | Source |
|---|---|
| Hippuran-131 | DrugCentral |
| Hippuran I131 | DrugCentral |
| iodohippurate sodium I131 | ChEBI |
| iodohippurate sodium (131I) | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 4828 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:881-17-4 | DrugCentral |