EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H27N3O3S |
| Net Charge | 0 |
| Average Mass | 413.543 |
| Monoisotopic Mass | 413.17731 |
| SMILES | CCOC(=O)Nc1ccc2c(c1)N(C(=O)CCN(CC)CC)c1ccccc1S2 |
| InChI | InChI=1S/C22H27N3O3S/c1-4-24(5-2)14-13-21(26)25-17-9-7-8-10-19(17)29-20-12-11-16(15-18(20)25)23-22(27)28-6-3/h7-12,15H,4-6,13-14H2,1-3H3,(H,23,27) |
| InChIKey | PQXGNJKJMFUPPM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethacizine (CHEBI:134732) has role anti-arrhythmia drug (CHEBI:38070) |
| ethacizine (CHEBI:134732) is a phenothiazines (CHEBI:38093) |
| Synonyms | Source |
|---|---|
| etacizin | DrugCentral |
| ethacizin | DrugCentral |
| Ethacizine | ChEMBL |
| ethacizine HCl | DrugCentral |
| ethacizine hydrochloride | DrugCentral |
| Ethacyzin | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 4835 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:33414-33-4 | DrugCentral |