EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H19F8N5O2 |
| Net Charge | 0 |
| Average Mass | 489.367 |
| Monoisotopic Mass | 489.14110 |
| SMILES | N[C@@H](CC(=O)N1CCc2c(nc(C(F)(F)F)nc2C(F)(F)F)C1)CN1CC(F)(F)CCC1=O |
| InChI | InChI=1S/C18H19F8N5O2/c19-16(20)3-1-12(32)31(8-16)6-9(27)5-13(33)30-4-2-10-11(7-30)28-15(18(24,25)26)29-14(10)17(21,22)23/h9H,1-8,27H2/t9-/m0/s1 |
| InChIKey | ZWPRRQZNBDYKLH-VIFPVBQESA-N |
| Roles Classification |
|---|
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gemigliptin (CHEBI:134731) has functional parent β-amino acid (CHEBI:33706) |
| gemigliptin (CHEBI:134731) has role antineoplastic agent (CHEBI:35610) |
| gemigliptin (CHEBI:134731) has role hypoglycemic agent (CHEBI:35526) |
| gemigliptin (CHEBI:134731) has role renoprotective agent (CHEBI:231911) |
| gemigliptin (CHEBI:134731) is a organonitrogen compound (CHEBI:35352) |
| gemigliptin (CHEBI:134731) is a organooxygen compound (CHEBI:36963) |
| INNs | Source |
|---|---|
| gemigliptina | WHO MedNet |
| gemigliptine | WHO MedNet |
| Synonyms | Source |
|---|---|
| Gemigliptin | ChEMBL |
| LC-15-0444 | ChEMBL |
| LC-150444 | ChEMBL |
| LC15-0444 | DrugCentral |
| zemiglo | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 4833 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:911637-19-9 | DrugCentral |