EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H25BrN2O3S |
| Net Charge | 0 |
| Average Mass | 477.424 |
| Monoisotopic Mass | 476.07693 |
| SMILES | CCOC(=O)c1c(CSc2ccccc2)n(C)c2cc(Br)c(O)c(CN(C)C)c12 |
| InChI | InChI=1S/C22H25BrN2O3S/c1-5-28-22(27)20-18(13-29-14-9-7-6-8-10-14)25(4)17-11-16(23)21(26)15(19(17)20)12-24(2)3/h6-11,26H,5,12-13H2,1-4H3 |
| InChIKey | KCFYEAOKVJSACF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| umifenovir (CHEBI:134730) is a indolyl carboxylic acid (CHEBI:46867) |
| Synonyms | Source |
|---|---|
| arbidol | DrugCentral |
| arbidole | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 4868 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:131707-25-0 | DrugCentral |