EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24N4O4 |
| Net Charge | 0 |
| Average Mass | 384.436 |
| Monoisotopic Mass | 384.17976 |
| SMILES | CCn1c(=O)c2c(nc(/C=C/c3ccc(OC)c(OC)c3)n2C)n(CC)c1=O |
| InChI | InChI=1S/C20H24N4O4/c1-6-23-18-17(19(25)24(7-2)20(23)26)22(3)16(21-18)11-9-13-8-10-14(27-4)15(12-13)28-5/h8-12H,6-7H2,1-5H3/b11-9+ |
| InChIKey | IQVRBWUUXZMOPW-PKNBQFBNSA-N |
| Roles Classification |
|---|
| Application: | antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| istradefylline (CHEBI:134726) has role antiparkinson drug (CHEBI:48407) |
| istradefylline (CHEBI:134726) is a oxopurine (CHEBI:25810) |
| INN | Source |
|---|---|
| istradefilina | WHO MedNet |
| Synonyms | Source |
|---|---|
| Istradefylline | ChEMBL |
| KW-6002 | DrugCentral |
| KW6002 | DrugCentral |
| nouriast | DrugCentral |
| Brand Name | Source |
|---|---|
| Nourianz | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 4882 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:155270-99-8 | DrugCentral |
| Citations |
|---|