EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H30N12O8S2 |
| Net Charge | 0 |
| Average Mass | 666.703 |
| Monoisotopic Mass | 666.17510 |
| SMILES | [H][C@]12SCC(C[n+]3cc(NC(=O)NCCN)c(N)n3C)=C(C(=O)[O-])N1C(=O)[C@H]2NC(=O)/C(=N\OC(C)(C)C(=O)O)c1nsc(N)n1 |
| InChI | InChI=1S/C23H30N12O8S2/c1-23(2,20(40)41)43-31-11(15-30-21(26)45-32-15)16(36)29-12-17(37)35-13(19(38)39)9(8-44-18(12)35)6-34-7-10(14(25)33(34)3)28-22(42)27-5-4-24/h7,12,18,25H,4-6,8,24H2,1-3H3,(H7,26,27,28,29,30,32,36,38,39,40,41,42)/b31-11-/t12-,18-/m1/s1 |
| InChIKey | JHFNIHVVXRKLEF-DCZLAGFPSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ceftolozane (CHEBI:134719) is a cephalosporin (CHEBI:23066) |
| ceftolozane (CHEBI:134719) is a thiadiazoles (CHEBI:38099) |
| IUPAC Name |
|---|
| 7-{[(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-{[(2-carboxypropan-2-yl)oxy]imino}acetyl]amino}-3-[ (5-amino-4-{[(2-aminoethyl)carbamoyl]amino}-1-methyl-1H-pyrazol-2-ium-2-yl)methyl]-3,4-didehydrocepham-4-carboxylate |
| INNs | Source |
|---|---|
| ceftolozane | ChemIDplus |
| ceftolozane | WHO MedNet |
| ceftolozano | WHO MedNet |
| ceftolozanum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (6R,7R)-3-[(5-amino-4-{[(2-aminoethyl)carbamoyl]amino}-1-methyl-1H-pyrazol-2-ium-2-yl)methyl]-7-{[(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-{[(2-carboxypropan-2-yl)oxy]imino}acetyl]amino}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate | IUPAC |
| CXA-101 | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| Ceftolozane | Wikipedia |
| US2017233408 | Patent |
| WO2016028670 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:24720344 | Reaxys |
| CAS:689293-68-3 | DrugCentral |
| CAS:689293-68-3 | ChemIDplus |
| Citations |
|---|