EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19FN2O2 |
| Net Charge | 0 |
| Average Mass | 302.349 |
| Monoisotopic Mass | 302.14306 |
| SMILES | C[C@H](NCc1ccc(OCc2cccc(F)c2)cc1)C(N)=O |
| InChI | InChI=1S/C17H19FN2O2/c1-12(17(19)21)20-10-13-5-7-16(8-6-13)22-11-14-3-2-4-15(18)9-14/h2-9,12,20H,10-11H2,1H3,(H2,19,21)/t12-/m0/s1 |
| InChIKey | NEMGRZFTLSKBAP-LBPRGKRZSA-N |
| Roles Classification |
|---|
| Applications: | renoprotective agent Any compound that is able to prevent damage to the kidneys. antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| safinamide (CHEBI:134718) has role antiparkinson drug (CHEBI:48407) |
| safinamide (CHEBI:134718) has role renoprotective agent (CHEBI:231911) |
| safinamide (CHEBI:134718) is a amino acid amide (CHEBI:22475) |
| INN | Source |
|---|---|
| safinamida | WHO MedNet |
| Synonyms | Source |
|---|---|
| EMD 1195686 | DrugCentral |
| EMD-1195686 | DrugCentral |
| Safinamide | ChEMBL |
| safinamide mesilate | DrugCentral |
| safinamide mesylate | DrugCentral |
| safinamide methanesulfonate | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 4921 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:133865-89-1 | DrugCentral |
| Citations |
|---|