EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H29NO5 |
| Net Charge | 0 |
| Average Mass | 411.498 |
| Monoisotopic Mass | 411.20457 |
| SMILES | CCOC(=O)[C@H](C)C[C@@H](Cc1ccc(-c2ccccc2)cc1)NC(=O)CCC(=O)O |
| InChI | InChI=1S/C24H29NO5/c1-3-30-24(29)17(2)15-21(25-22(26)13-14-23(27)28)16-18-9-11-20(12-10-18)19-7-5-4-6-8-19/h4-12,17,21H,3,13-16H2,1-2H3,(H,25,26)(H,27,28)/t17-,21+/m1/s1 |
| InChIKey | PYNXFZCZUAOOQC-UTKZUKDTSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sacubitril (CHEBI:134714) has functional parent γ-amino acid (CHEBI:33707) |
| sacubitril (CHEBI:134714) has role antihypertensive agent (CHEBI:35674) |
| sacubitril (CHEBI:134714) has role antiviral agent (CHEBI:22587) |
| sacubitril (CHEBI:134714) has role cardiovascular drug (CHEBI:35554) |
| sacubitril (CHEBI:134714) is a biphenyls (CHEBI:22888) |
| sacubitril (CHEBI:134714) is a organic molecular entity (CHEBI:50860) |
| sacubitril (CHEBI:134714) is a organonitrogen compound (CHEBI:35352) |
| sacubitril (CHEBI:134714) is a organooxygen compound (CHEBI:36963) |
| INN | Source |
|---|---|
| sacubitrilo | WHO MedNet |
| Synonyms | Source |
|---|---|
| AHU-377 | ChEMBL |
| AHU377 | DrugCentral |
| Sacubitril | ChEMBL |
| sucabitril | DrugCentral |
| Brand Name | Source |
|---|---|
| Sacubitril component of entresto | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 5012 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:149709-62-6 | DrugCentral |
| Citations |
|---|