EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H29NO5 |
| Net Charge | 0 |
| Average Mass | 411.498 |
| Monoisotopic Mass | 411.20457 |
| SMILES | CCOC(=O)[C@H](C)C[C@@H](Cc1ccc(-c2ccccc2)cc1)NC(=O)CCC(=O)O |
| InChI | InChI=1S/C24H29NO5/c1-3-30-24(29)17(2)15-21(25-22(26)13-14-23(27)28)16-18-9-11-20(12-10-18)19-7-5-4-6-8-19/h4-12,17,21H,3,13-16H2,1-2H3,(H,25,26)(H,27,28)/t17-,21+/m1/s1 |
| InChIKey | PYNXFZCZUAOOQC-UTKZUKDTSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sacubitril (CHEBI:134714) has role antihypertensive agent (CHEBI:35674) |
| sacubitril (CHEBI:134714) has role antiviral agent (CHEBI:22587) |
| sacubitril (CHEBI:134714) has role cardiovascular drug (CHEBI:35554) |
| sacubitril (CHEBI:134714) is a biphenyls (CHEBI:22888) |
| INN | Source |
|---|---|
| sacubitrilo | WHO MedNet |
| Synonyms | Source |
|---|---|
| AHU-377 | ChEMBL |
| AHU377 | DrugCentral |
| Sacubitril | ChEMBL |
| sucabitril | DrugCentral |
| Brand Name | Source |
|---|---|
| Sacubitril component of entresto | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 5012 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:149709-62-6 | DrugCentral |
| Citations |
|---|