EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H26ClNO |
| Net Charge | 0 |
| Average Mass | 295.854 |
| Monoisotopic Mass | 295.17029 |
| SMILES | Clc1ccc(CCCOCCCN2CCCCC2)cc1 |
| InChI | InChI=1S/C17H26ClNO/c18-17-9-7-16(8-10-17)6-4-14-20-15-5-13-19-11-2-1-3-12-19/h7-10H,1-6,11-15H2 |
| InChIKey | NNACHAUCXXVJSP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | renoprotective agent Any compound that is able to prevent damage to the kidneys. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pitolisant (CHEBI:134709) has role antiparkinson drug (CHEBI:48407) |
| pitolisant (CHEBI:134709) has role antipsychotic agent (CHEBI:35476) |
| pitolisant (CHEBI:134709) has role renoprotective agent (CHEBI:231911) |
| pitolisant (CHEBI:134709) is a organochlorine compound (CHEBI:36683) |
| Synonyms | Source |
|---|---|
| BF-2.649 | ChEMBL |
| BF-2649 | ChEMBL |
| BF2.649 | DrugCentral |
| HBS-101 | ChEMBL |
| Pitolisant | ChEMBL |
| pitolisant hydrochloride | DrugCentral |
| Brand Name | Source |
|---|---|
| Wakix, europe | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 5048 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:362665-56-3 | DrugCentral |
| Citations |
|---|