EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H29NO4S |
| Net Charge | 0 |
| Average Mass | 439.577 |
| Monoisotopic Mass | 439.18173 |
| SMILES | CCO[C@@H](Cc1ccc(OCCn2c(C)ccc2-c2ccc(SC)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C25H29NO4S/c1-4-29-24(25(27)28)17-19-6-10-21(11-7-19)30-16-15-26-18(2)5-14-23(26)20-8-12-22(31-3)13-9-20/h5-14,24H,4,15-17H2,1-3H3,(H,27,28)/t24-/m0/s1 |
| InChIKey | MRWFZSLZNUJVQW-DEOSSOPVSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | PPARgamma agonist A PPAR modulator which activates the peroxisome proliferator-activated receptor-γ. PPARalpha agonist A PPAR modulator which activates the peroxisome proliferator-activated receptor-α. |
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. hepatoprotective agent Any compound that is able to prevent damage to the liver. renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| saroglitazar (CHEBI:134708) has role hepatoprotective agent (CHEBI:62868) |
| saroglitazar (CHEBI:134708) has role hypoglycemic agent (CHEBI:35526) |
| saroglitazar (CHEBI:134708) has role PPARα agonist (CHEBI:70782) |
| saroglitazar (CHEBI:134708) has role PPARγ agonist (CHEBI:71554) |
| saroglitazar (CHEBI:134708) has role renoprotective agent (CHEBI:231911) |
| saroglitazar (CHEBI:134708) is a aromatic ether (CHEBI:35618) |
| saroglitazar (CHEBI:134708) is a methyl sulfide (CHEBI:86315) |
| saroglitazar (CHEBI:134708) is a monocarboxylic acid (CHEBI:25384) |
| saroglitazar (CHEBI:134708) is a pyrroles (CHEBI:26455) |
| IUPAC Name |
|---|
| (2S)-2-ethoxy-3-[4-(2-{2-methyl-5-[4-(methylthio)phenyl]-1H-pyrrol-1-yl}ethoxy)phenyl]propanoic acid |
| INNs | Source |
|---|---|
| saroglitazar | WHO MedNet |
| saroglitazar | WHO MedNet |
| saroglitazar | WHO MedNet |
| saroglitazarum | WHO MedNet |
| Brand Name | Source |
|---|---|
| Lipaglyn | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 5047 | DrugCentral |
| Saroglitazar | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11765048 | Reaxys |
| CAS:495399-09-2 | DrugCentral |
| CAS:495399-09-2 | ChemIDplus |
| Citations |
|---|