EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H29NO4S |
| Net Charge | 0 |
| Average Mass | 439.577 |
| Monoisotopic Mass | 439.18173 |
| SMILES | CCO[C@@H](Cc1ccc(OCCn2c(C)ccc2-c2ccc(SC)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C25H29NO4S/c1-4-29-24(25(27)28)17-19-6-10-21(11-7-19)30-16-15-26-18(2)5-14-23(26)20-8-12-22(31-3)13-9-20/h5-14,24H,4,15-17H2,1-3H3,(H,27,28)/t24-/m0/s1 |
| InChIKey | MRWFZSLZNUJVQW-DEOSSOPVSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | PPARalpha agonist A PPAR modulator which activates the peroxisome proliferator-activated receptor-α. PPARgamma agonist A PPAR modulator which activates the peroxisome proliferator-activated receptor-γ. |
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| saroglitazar (CHEBI:134708) has role hypoglycemic agent (CHEBI:35526) |
| saroglitazar (CHEBI:134708) has role PPARα agonist (CHEBI:70782) |
| saroglitazar (CHEBI:134708) has role PPARγ agonist (CHEBI:71554) |
| saroglitazar (CHEBI:134708) is a aromatic ether (CHEBI:35618) |
| saroglitazar (CHEBI:134708) is a methyl sulfide (CHEBI:86315) |
| saroglitazar (CHEBI:134708) is a monocarboxylic acid (CHEBI:25384) |
| saroglitazar (CHEBI:134708) is a pyrroles (CHEBI:26455) |
| IUPAC Name |
|---|
| (2S)-2-ethoxy-3-[4-(2-{2-methyl-5-[4-(methylthio)phenyl]-1H-pyrrol-1-yl}ethoxy)phenyl]propanoic acid |
| INNs | Source |
|---|---|
| saroglitazarum | WHO MedNet |
| saroglitazar | WHO MedNet |
| saroglitazar | WHO MedNet |
| saroglitazar | WHO MedNet |
| Brand Name | Source |
|---|---|
| Lipaglyn | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 5047 | DrugCentral |
| Saroglitazar | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11765048 | Reaxys |
| CAS:495399-09-2 | DrugCentral |
| CAS:495399-09-2 | ChemIDplus |
| Citations |
|---|