EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8NO2 |
| Net Charge | 0 |
| Average Mass | 132.125 |
| Monoisotopic Mass | 132.05644 |
| SMILES | N[C@]1(C(=O)O)C[C@@H]([18F])C1 |
| InChI | InChI=1S/C5H8FNO2/c6-3-1-5(7,2-3)4(8)9/h3H,1-2,7H2,(H,8,9)/t3-,5-/i6-1 |
| InChIKey | NTEDWGYJNHZKQW-DGMDOPGDSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | radiopharmaceutical Any pharmaceutical compound containing a radioisotope. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fluciclovine (18F) (CHEBI:134703) has role radioactive imaging agent (CHEBI:37336) |
| fluciclovine (18F) (CHEBI:134703) is a 18F radiopharmaceutical (CHEBI:49127) |
| fluciclovine (18F) (CHEBI:134703) is a cyclobutanes (CHEBI:156473) |
| fluciclovine (18F) (CHEBI:134703) is a fluoroamino acid (CHEBI:24068) |
| fluciclovine (18F) (CHEBI:134703) is a monocarboxylic acid (CHEBI:25384) |
| fluciclovine (18F) (CHEBI:134703) is a primary amino compound (CHEBI:50994) |
| fluciclovine (18F) (CHEBI:134703) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| (1r,3r)-1-amino-3-(18F)fluorocyclobutanecarboxylic acid |
| INNs | Source |
|---|---|
| fluciclovina (18F) | WHO MedNet |
| fluciclovine (18F) | WHO MedNet |
| fluciclovine (18F) | WHO MedNet |
| fluciclovinum (18F) | WHO MedNet |
| Synonyms | Source |
|---|---|
| (1r,3r)-1-amino-3-(18F)fluorocyclobutane-1-carboxylic acid | IUPAC |
| Axumin | KEGG DRUG |
| FACBC F-18 | DrugBank |
| fluciclovine F 18 | DrugBank |
| fluciclovine F-18 | ChemIDplus |
| fluciclovine F18 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 23313216 | ChemSpider |
| 5153 | DrugCentral |
| D10860 | KEGG DRUG |
| DB13146 | DrugBank |
| EP2793954 | Patent |
| Fluciclovine_(18F) | Wikipedia |
| GB2561122 | Patent |
| US10967077 | Patent |
| WO2011044410 | Patent |
| WO2014023775 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:222727-39-1 | ChemIDplus |
| Citations |
|---|