EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10Cl2N4O6 |
| Net Charge | 0 |
| Average Mass | 413.173 |
| Monoisotopic Mass | 411.99774 |
| SMILES | Cc1c(Cl)c(C)[n+]([O-])c(Cl)c1-c1noc(-c2cc(O)c(O)c([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C15H10Cl2N4O6/c1-5-10(13(17)20(24)6(2)11(5)16)14-18-15(27-19-14)7-3-8(21(25)26)12(23)9(22)4-7/h3-4,22-23H,1-2H3 |
| InChIKey | ASOADIZOVZTJSR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| opicapone (CHEBI:134699) has role antiparkinson drug (CHEBI:48407) |
| opicapone (CHEBI:134699) is a organic molecular entity (CHEBI:50860) |
| opicapone (CHEBI:134699) is a oxadiazole (CHEBI:46685) |
| opicapone (CHEBI:134699) is a ring assembly (CHEBI:36820) |
| INN | Source |
|---|---|
| opicapona | WHO MedNet |
| Synonyms | Source |
|---|---|
| BIA 9-1067 | DrugCentral |
| BIA-9-1067 | ChEMBL |
| BIA-91067 | ChEMBL |
| ongentys | DrugCentral |
| Opicapone | ChEMBL |
| Brand Name | Source |
|---|---|
| Ontilyv | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 5143 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:923287-50-7 | DrugCentral |
| Citations |
|---|