EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O4S.C19H18FN3O |
| Net Charge | 0 |
| Average Mass | 555.672 |
| Monoisotopic Mass | 555.22032 |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(CS(=O)(=O)O)C(=O)C2.CNCc1ccc(-c2nc3cc(F)cc4c3c2CCNC4=O)cc1 |
| InChI | InChI=1S/C19H18FN3O.C10H16O4S/c1-21-10-11-2-4-12(5-3-11)18-14-6-7-22-19(24)15-8-13(20)9-16(23-18)17(14)15;1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14/h2-5,8-9,21,23H,6-7,10H2,1H3,(H,22,24);7H,3-6H2,1-2H3,(H,12,13,14)/t;7-,10-/m.1/s1 |
| InChIKey | INBJJAFXHQQSRW-STOWLHSFSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 2.4.2.30 (NAD(+) ADP-ribosyltransferase) inhibitor An EC 2.4.2.* (pentosyltransferase) inhibitor that interferes with the action of a NAD+ ADP-ribosyltransferase (EC 2.4.2.30). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rucaparib camsylate (CHEBI:134692) has part (S)-camphorsulfonate (CHEBI:55408) |
| rucaparib camsylate (CHEBI:134692) has part rucaparib(1+) (CHEBI:134695) |
| rucaparib camsylate (CHEBI:134692) has role EC 2.4.2.30 (NAD+ ADP-ribosyltransferase) inhibitor (CHEBI:62913) |
| rucaparib camsylate (CHEBI:134692) is a azepinoindole (CHEBI:134691) |
| rucaparib camsylate (CHEBI:134692) is a camphorsulfonate salt (CHEBI:55339) |
| IUPAC Name |
|---|
| [4-(8-fluoro-6-oxo-3,4,5,6-tetrahydro-1H-azepino[5,4,3-cd]indol-2-yl)phenyl]-N-methylmethanaminium [(1S,4R)-7,7-dimethyl-2-oxobicyclo[2.2.1]heptan-1-yl]methanesulfonate |
| Synonyms | Source |
|---|---|
| rucaparib camphorsulfonate | ChEBI |
| CO-338 | ChemIDplus |
| PF-1367338-BW | ChemIDplus |
| Brand Name | Source |
|---|---|
| Rubraca | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21762553 | Reaxys |
| CAS:1859053-21-6 | ChemIDplus |
| Citations |
|---|