EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H14N2O7 |
| Net Charge | 0 |
| Average Mass | 310.262 |
| Monoisotopic Mass | 310.08010 |
| SMILES | O=C(O)C[C@@H]1[C@@H](C(=O)O)NC[C@@H]1c1ccc(C(=O)O)nc1=O |
| InChI | InChI=1S/C13H14N2O7/c16-9(17)3-6-7(4-14-10(6)13(21)22)5-1-2-8(12(19)20)15-11(5)18/h1-2,6-7,10,14H,3-4H2,(H,15,18)(H,16,17)(H,19,20)(H,21,22)/t6-,7+,10-/m0/s1 |
| InChIKey | CWXNEBSQRIECMV-PJKMHFRUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Apis cerana (ncbitaxon:7461) | - | MetaboLights (MTBLS379) | |
| Clitocybe amoenolens (ncbitaxon:1144693) | - | PubMed (12882485) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. neurotoxin A poison that interferes with the functions of the nervous system. NMDA receptor agonist An excitatory amino acid agonist which binds to NMDA receptors and triggers a response. |
| Application: | NMDA receptor agonist An excitatory amino acid agonist which binds to NMDA receptors and triggers a response. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acromelic acid A (CHEBI:134690) has functional parent L-proline (CHEBI:17203) |
| acromelic acid A (CHEBI:134690) has role fungal metabolite (CHEBI:76946) |
| acromelic acid A (CHEBI:134690) has role neurotoxin (CHEBI:50910) |
| acromelic acid A (CHEBI:134690) has role NMDA receptor agonist (CHEBI:64571) |
| acromelic acid A (CHEBI:134690) is a pyridone (CHEBI:38183) |
| acromelic acid A (CHEBI:134690) is a pyrrolidinecarboxylic acid (CHEBI:46767) |
| acromelic acid A (CHEBI:134690) is a tricarboxylic acid (CHEBI:27093) |
| IUPAC Name |
|---|
| 5-[(3S,4S,5S)-5-carboxy-4-(carboxymethyl)pyrrolidin-3-yl]-6-oxo-1,6-dihydropyridine-2-carboxylic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3628137 | Reaxys |
| CAS:86630-09-3 | ChemIDplus |
| Citations |
|---|