EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H23NO4.HCl |
| Net Charge | 0 |
| Average Mass | 377.868 |
| Monoisotopic Mass | 377.13939 |
| SMILES | Cl.O=C1CC[C@@]2(O)[C@H]3Cc4ccc(O)c5c4[C@@]2(CCN3CC2CC2)[C@H]1O5 |
| InChI | InChI=1S/C20H23NO4.ClH/c22-13-4-3-12-9-15-20(24)6-5-14(23)18-19(20,16(12)17(13)25-18)7-8-21(15)10-11-1-2-11;/h3-4,11,15,18,22,24H,1-2,5-10H2;1H/t15-,18+,19+,20-;/m1./s1 |
| InChIKey | RHBRMCOKKKZVRY-ITLPAZOVSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | mu-opioid receptor antagonist Any compound that exhibits antagonist activity at the μ-opioid receptor |
| Applications: | antidote to opioid poisoning A role borne by a molecule that acts to counteract or neutralise the deleterious effects of opioids. central nervous system depressant A loosely defined group of drugs that tend to reduce the activity of the central nervous system. mu-opioid receptor antagonist Any compound that exhibits antagonist activity at the μ-opioid receptor |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| naltrexone hydrochloride (CHEBI:134687) has part naltrexone(1+) (CHEBI:134688) |
| naltrexone hydrochloride (CHEBI:134687) has role antidote to opioid poisoning (CHEBI:90755) |
| naltrexone hydrochloride (CHEBI:134687) has role central nervous system depressant (CHEBI:35488) |
| naltrexone hydrochloride (CHEBI:134687) has role μ-opioid receptor antagonist (CHEBI:50137) |
| naltrexone hydrochloride (CHEBI:134687) is a hydrochloride (CHEBI:36807) |
| Incoming Relation(s) |
| Troxyca ER (CHEBI:134679) has part naltrexone hydrochloride (CHEBI:134687) |
| IUPAC Names |
|---|
| 17-(cyclopropylmethyl)-3,14-dihydroxy-4,5α-epoxymorphinan-6-one hydrochloride |
| (5α,17R)-17-(cyclopropylmethyl)-3,14-dihydroxy-6-oxo-4,5-epoxymorphinan-17-ium chloride |
| Synonyms | Source |
|---|---|
| 17-(Cyclopropylmethyl)-4,5-alpha-epoxy-3,14-dihydroxy-morphinan-6-one hydrochloride | ChemIDplus |
| naltrexone.HCl | ChEBI |
| naltrexone monohydrochloride | ChEBI |
| N-Cyclopropylmethyl-noroxymorphone hydrochloride | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D02095 | KEGG DRUG |
| DB00704 | DrugBank |
| Naltrexone | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3580333 | Reaxys |
| CAS:16676-29-2 | ChemIDplus |
| Citations |
|---|