EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10BNO3 |
| Net Charge | 0 |
| Average Mass | 251.050 |
| Monoisotopic Mass | 251.07537 |
| SMILES | N#Cc1ccc(Oc2ccc3c(c2)COB3O)cc1 |
| InChI | InChI=1S/C14H10BNO3/c16-8-10-1-3-12(4-2-10)19-13-5-6-14-11(7-13)9-18-15(14)17/h1-7,17H,9H2 |
| InChIKey | USZAGAREISWJDP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | phosphodiesterase IV inhibitor An EC 3.1.4.53 (3',5'-cyclic-AMP phosphodiesterase) inhibitor that specifically blocks the action of phosphodiesterase IV. |
| Applications: | antipsoriatic A drug used to treat psoriasis. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| crisaborole (CHEBI:134677) has role antipsoriatic (CHEBI:50748) |
| crisaborole (CHEBI:134677) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| crisaborole (CHEBI:134677) has role phosphodiesterase IV inhibitor (CHEBI:68844) |
| crisaborole (CHEBI:134677) is a aromatic ether (CHEBI:35618) |
| crisaborole (CHEBI:134677) is a benzoxaborole (CHEBI:78240) |
| crisaborole (CHEBI:134677) is a nitrile (CHEBI:18379) |
| IUPAC Name |
|---|
| 4-[(1-hydroxy-1,3-dihydro-2,1-benzoxaborol-5-yl)oxy]benzonitrile |
| INN | Source |
|---|---|
| crisaborole | KEGG DRUG |
| Synonyms | Source |
|---|---|
| AN 2728 | ChemIDplus |
| AN-2728 | ChemIDplus |
| AN2728 | ChEBI |
| Crisaborole topical ointment 2% | ChemIDplus |
| Brand Name | Source |
|---|---|
| Eucrisa | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D10873 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11622826 | Reaxys |
| CAS:906673-24-3 | KEGG DRUG |
| CAS:906673-24-3 | ChemIDplus |
| Citations |
|---|