EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H19NO2S |
| Net Charge | 0 |
| Average Mass | 205.323 |
| Monoisotopic Mass | 205.11365 |
| SMILES | CSCCCCCC[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C9H19NO2S/c1-13-7-5-3-2-4-6-8(10)9(11)12/h8H,2-7,10H2,1H3,(H,11,12)/t8-/m0/s1 |
| InChIKey | NBXNZQFZGOQQPE-QMMMGPOBSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-tetrahomomethionine zwitterion (CHEBI:134634) is a L-polyhomomethionine zwitterion (CHEBI:134631) |
| L-tetrahomomethionine zwitterion (CHEBI:134634) is a tetrahomomethionine zwitterion (CHEBI:58834) |
| L-tetrahomomethionine zwitterion (CHEBI:134634) is tautomer of L-tetrahomomethionine (CHEBI:137002) |
| Incoming Relation(s) |
| L-tetrahomomethionine (CHEBI:137002) is tautomer of L-tetrahomomethionine zwitterion (CHEBI:134634) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-8-(methylsulfanyl)octanoate |
| UniProt Name | Source |
|---|---|
| L-tetrahomomethionine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPDQT-349 | MetaCyc |