EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H17NO2S |
| Net Charge | 0 |
| Average Mass | 191.296 |
| Monoisotopic Mass | 191.09800 |
| SMILES | CSCCCCC[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C8H17NO2S/c1-12-6-4-2-3-5-7(9)8(10)11/h7H,2-6,9H2,1H3,(H,10,11)/t7-/m0/s1 |
| InChIKey | UKDJCWUSWYBRDM-ZETCQYMHSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-trihomomethionine zwitterion (CHEBI:134633) is a L-polyhomomethionine zwitterion (CHEBI:134631) |
| L-trihomomethionine zwitterion (CHEBI:134633) is a trihomomethionine zwitterion (CHEBI:58833) |
| L-trihomomethionine zwitterion (CHEBI:134633) is tautomer of L-trihomomethionine (CHEBI:136999) |
| Incoming Relation(s) |
| L-trihomomethionine (CHEBI:136999) is tautomer of L-trihomomethionine zwitterion (CHEBI:134633) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-7-(methylsulfanyl)heptanoate |
| UniProt Name | Source |
|---|---|
| L-trihomomethionine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPDQT-404 | MetaCyc |