EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14HD27O2 |
| Net Charge | 0 |
| Average Mass | 255.541 |
| Monoisotopic Mass | 255.37840 |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O |
| InChI | InChI=1S/C14H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h2-13H2,1H3,(H,15,16)/i1D3,2D2,3D2,4D2,5D2,6D2,7D2,8D2,9D2,10D2,11D2,12D2,13D2 |
| InChIKey | TUNFSRHWOTWDNC-RZVOLPTOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Candida albicans (ncbitaxon:5476) | - | MetaboLights (MTBLS370) | |
| Staphylococcus aureus (ncbitaxon:1280) | - | MetaboLights (MTBLS370) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetradecanoic-d27 acid (CHEBI:134623) has functional parent tetradecanoic acid (CHEBI:28875) |
| tetradecanoic-d27 acid (CHEBI:134623) has role bacterial metabolite (CHEBI:76969) |
| tetradecanoic-d27 acid (CHEBI:134623) has role fungal metabolite (CHEBI:76946) |
| tetradecanoic-d27 acid (CHEBI:134623) is a deuterated fatty acid (CHEBI:75427) |
| tetradecanoic-d27 acid (CHEBI:134623) is a long-chain fatty acid (CHEBI:15904) |
| tetradecanoic-d27 acid (CHEBI:134623) is a straight-chain saturated fatty acid (CHEBI:39418) |
| IUPAC Name |
|---|
| (2H27)tetradecanoic acid |
| Synonyms | Source |
|---|---|
| myristic acid-d27 | ChEBI |
| myristic-d27 acid | ChEBI |
| perdeuteromyristic acid | ChEBI |
| perdeuterotetradecanoic acid | ChEBI |
| tetradecanoic acid-d27 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1897910 | Reaxys |
| Citations |
|---|