EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10N2O3 |
| Net Charge | 0 |
| Average Mass | 158.157 |
| Monoisotopic Mass | 158.06914 |
| SMILES | CC(=O)CN(CC(C)=O)N=O |
| InChI | InChI=1S/C6H10N2O3/c1-5(9)3-8(7-11)4-6(2)10/h3-4H2,1-2H3 |
| InChIKey | AKRYBBWYDSDZHG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nitrosobis(2-oxopropyl)amine (CHEBI:134609) has role carcinogenic agent (CHEBI:50903) |
| nitrosobis(2-oxopropyl)amine (CHEBI:134609) is a ketone (CHEBI:17087) |
| nitrosobis(2-oxopropyl)amine (CHEBI:134609) is a nitrosamine (CHEBI:35803) |
| IUPAC Name |
|---|
| N,N-bis(2-oxopropyl)nitrous amide |
| Synonyms | Source |
|---|---|
| 2,2'-dioxo-di-n-propylnitrosamine | ChemIDplus |
| 2,2'-dioxopropyl-N-propylnitrosamine | ChemIDplus |
| bis-(2-oxopropyl)-N-nitrosamine | ChemIDplus |
| BOP | ChemIDplus |
| N,N-di(2-oxopropyl)nitrosamine | ChemIDplus |
| N-nitroso-N,N-di(2-oxypropyl)amine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2245698 | Reaxys |
| CAS:60599-38-4 | ChemIDplus |
| Citations |
|---|