EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H13N5O4 |
| Net Charge | 0 |
| Average Mass | 291.267 |
| Monoisotopic Mass | 291.09675 |
| SMILES | N#Cc1cn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c2ncnc(N)c12 |
| InChI | InChI=1S/C12H13N5O4/c13-1-5-2-17(11-7(5)10(14)15-4-16-11)12-9(20)8(19)6(3-18)21-12/h2,4,6,8-9,12,18-20H,3H2,(H2,14,15,16)/t6-,8-,9-,12-/m1/s1 |
| InChIKey | XOKJUSAYZUAMGJ-WOUKDFQISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces diastatochromogenes (ncbitaxon:1628) | - | PubMed (23775805) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| toyocamycin (CHEBI:134606) has role antimetabolite (CHEBI:35221) |
| toyocamycin (CHEBI:134606) has role antineoplastic agent (CHEBI:35610) |
| toyocamycin (CHEBI:134606) has role apoptosis inducer (CHEBI:68495) |
| toyocamycin (CHEBI:134606) has role bacterial metabolite (CHEBI:76969) |
| toyocamycin (CHEBI:134606) is a N-glycosylpyrrolopyrimidine (CHEBI:48036) |
| toyocamycin (CHEBI:134606) is a antibiotic antifungal agent (CHEBI:86478) |
| toyocamycin (CHEBI:134606) is a nitrile (CHEBI:18379) |
| toyocamycin (CHEBI:134606) is a ribonucleoside (CHEBI:18254) |
| IUPAC Name |
|---|
| 4-amino-7-β-D-ribofuranosyl-7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile |
| Synonyms | Source |
|---|---|
| 4-amino-5-cyano-7-(D-ribofuranosyl)-7H-pyrrolo(2,3-d)pyrimidine | ChemIDplus |
| 7-deaza-7-cyanoadenosine | ChemIDplus |
| A-399-Y4 | ChemIDplus |
| Ahygroscopin-B | ChemIDplus |
| Antibiotic 1037 | ChemIDplus |
| Antibiotic A-399-Y4 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:48454 | Reaxys |
| CAS:606-58-6 | ChemIDplus |
| Citations |
|---|