EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H13N5O4 |
| Net Charge | 0 |
| Average Mass | 291.267 |
| Monoisotopic Mass | 291.09675 |
| SMILES | N#Cc1cn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c2ncnc(N)c12 |
| InChI | InChI=1S/C12H13N5O4/c13-1-5-2-17(11-7(5)10(14)15-4-16-11)12-9(20)8(19)6(3-18)21-12/h2,4,6,8-9,12,18-20H,3H2,(H2,14,15,16)/t6-,8-,9-,12-/m1/s1 |
| InChIKey | XOKJUSAYZUAMGJ-WOUKDFQISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces diastatochromogenes (ncbitaxon:1628) | - | PubMed (23775805) |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| toyocamycin (CHEBI:134606) has role antimetabolite (CHEBI:35221) |
| toyocamycin (CHEBI:134606) has role antineoplastic agent (CHEBI:35610) |
| toyocamycin (CHEBI:134606) has role apoptosis inducer (CHEBI:68495) |
| toyocamycin (CHEBI:134606) has role bacterial metabolite (CHEBI:76969) |
| toyocamycin (CHEBI:134606) is a N-glycosylpyrrolopyrimidine (CHEBI:48036) |
| toyocamycin (CHEBI:134606) is a antibiotic antifungal agent (CHEBI:86478) |
| toyocamycin (CHEBI:134606) is a nitrile (CHEBI:18379) |
| toyocamycin (CHEBI:134606) is a ribonucleoside (CHEBI:18254) |
| IUPAC Name |
|---|
| 4-amino-7-β-D-ribofuranosyl-7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile |
| Synonyms | Source |
|---|---|
| 4-amino-5-cyano-7-(D-ribofuranosyl)-7H-pyrrolo(2,3-d)pyrimidine | ChemIDplus |
| 7-deaza-7-cyanoadenosine | ChemIDplus |
| A-399-Y4 | ChemIDplus |
| Ahygroscopin-B | ChemIDplus |
| Antibiotic 1037 | ChemIDplus |
| Antibiotic A-399-Y4 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:48454 | Reaxys |
| CAS:606-58-6 | ChemIDplus |
| Citations |
|---|