EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H35Cl2FN4O3 |
| Net Charge | 0 |
| Average Mass | 577.528 |
| Monoisotopic Mass | 576.20702 |
| SMILES | [H][C@]1(c2cccc(Cl)c2F)[C@H](C(=O)NCCN2CCOCC2)N[C@H](CC(C)(C)C)[C@]12C(=O)Nc1cc(Cl)ccc12 |
| InChI | InChI=1S/C29H35Cl2FN4O3/c1-28(2,3)16-22-29(19-8-7-17(30)15-21(19)34-27(29)38)23(18-5-4-6-20(31)24(18)32)25(35-22)26(37)33-9-10-36-11-13-39-14-12-36/h4-8,15,22-23,25,35H,9-14,16H2,1-3H3,(H,33,37)(H,34,38)/t22-,23+,25-,29+/m1/s1 |
| InChIKey | YTBYOWZWBDYLQF-BGLPIVGWSA-N |
| Roles Classification |
|---|
| Biological Role: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| MI-63 (CHEBI:134602) has role apoptosis inducer (CHEBI:68495) |
| MI-63 (CHEBI:134602) is a azaspiro compound (CHEBI:35624) |
| MI-63 (CHEBI:134602) is a monochlorobenzenes (CHEBI:83403) |
| MI-63 (CHEBI:134602) is a monofluorobenzenes (CHEBI:83575) |
| MI-63 (CHEBI:134602) is a morpholines (CHEBI:38785) |
| MI-63 (CHEBI:134602) is a oxindoles (CHEBI:38459) |
| MI-63 (CHEBI:134602) is a pyrrolidines (CHEBI:38260) |
| MI-63 (CHEBI:134602) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| (2'R,3S,4'S,5'R)-6-chloro-4'-(3-chloro-2-fluorophenyl)-2'-(2,2-dimethylpropyl)-N-[2-(morpholin-4-yl)ethyl]-2-oxo-1,2-dihydrospiro[indole-3,3'-pyrrolidine]-5'-carboxamide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10506427 | Reaxys |
| Citations |
|---|