EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H36N2O7 |
| Net Charge | 0 |
| Average Mass | 512.603 |
| Monoisotopic Mass | 512.25225 |
| SMILES | [H][C@]12COC(=O)[C@]1([H])[C@H](c1cc(OC)c(O)c(OC)c1)c1cc3c(cc1[C@H]2CCN(C)CCN(C)C)OCO3 |
| InChI | InChI=1S/C28H36N2O7/c1-29(2)8-9-30(3)7-6-17-18-12-21-22(37-15-36-21)13-19(18)25(26-20(17)14-35-28(26)32)16-10-23(33-4)27(31)24(11-16)34-5/h10-13,17,20,25-26,31H,6-9,14-15H2,1-5H3/t17-,20-,25-,26+/m1/s1 |
| InChIKey | KLCCMMSKRMSMKI-QVNMXXJYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase (ATP-hydrolysing), EC 5.99.1.3 (also known as topoisomerase II and as DNA gyrase), which catalyses ATP-dependent breakage of both strands of DNA, passage of the unbroken strands through the breaks, and rejoining of the broken strands. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| TOP-53 (CHEBI:134547) has role antineoplastic agent (CHEBI:35610) |
| TOP-53 (CHEBI:134547) has role EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor (CHEBI:50750) |
| TOP-53 (CHEBI:134547) is a furonaphthodioxole (CHEBI:50307) |
| TOP-53 (CHEBI:134547) is a organic heterotetracyclic compound (CHEBI:38163) |
| TOP-53 (CHEBI:134547) is a phenols (CHEBI:33853) |
| TOP-53 (CHEBI:134547) is a tertiary amino compound (CHEBI:50996) |
| TOP-53 (CHEBI:134547) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (5R,5aR,8aR,9S)-9-(2-{[2-(dimethylamino)ethyl](methyl)amino}ethyl)-5-(4-hydroxy-3,5-dimethoxyphenyl)-5,8,8a,9-tetrahydrofuro[3',4':6,7]naphtho[2,3-d][1,3]dioxol-6(5aH)-one |
| Synonyms | Source |
|---|---|
| TOP 53 | ChEBI |
| 4'-demethyl-4β-(2-{N-[2-(N',N'-dimethylamino)ethyl]-N-methylamino}ethyl)-4-desoxypodophyllotoxin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6377812 | Reaxys |
| CAS:148262-19-5 | ChemIDplus |
| Citations |
|---|