EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18O3 |
| Net Charge | 0 |
| Average Mass | 186.251 |
| Monoisotopic Mass | 186.12559 |
| SMILES | C=CC(C)(O)C/C=C/C(C)(C)OO |
| InChI | InChI=1S/C10H18O3/c1-5-10(4,11)8-6-7-9(2,3)13-12/h5-7,11-12H,1,8H2,2-4H3/b7-6+ |
| InChIKey | KPPNFQDHKXOGMD-VOTSOKGWSA-N |
| Roles Classification |
|---|
| Biological Roles: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| linalool 7-hydroperoxide (CHEBI:134525) has role allergen (CHEBI:50904) |
| linalool 7-hydroperoxide (CHEBI:134525) is a linalool hydroperoxide (CHEBI:134523) |
| IUPAC Name |
|---|
| (5E)-7-hydroperoxy-3,7-dimethylocta-1,5-dien-3-ol |
| Synonyms | Source |
|---|---|
| 7-hydroperoxylinalool | ChEBI |
| Lin-7-OOH | ChEBI |
| linalool-7-OOH | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10154154 | Reaxys |
| Citations |
|---|