EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18O3 |
| Net Charge | 0 |
| Average Mass | 186.251 |
| Monoisotopic Mass | 186.12559 |
| SMILES | C=CC(C)(O)C/C=C(\OO)C(C)C |
| InChI | InChI=1S/C10H18O3/c1-5-10(4,11)7-6-9(13-12)8(2)3/h5-6,8,11-12H,1,7H2,2-4H3/b9-6- |
| InChIKey | UVKPTCRFZNDVBI-TWGQIWQCSA-N |
| Roles Classification |
|---|
| Biological Roles: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| linalool 6-hydroperoxide (CHEBI:134524) has role allergen (CHEBI:50904) |
| linalool 6-hydroperoxide (CHEBI:134524) is a linalool hydroperoxide (CHEBI:134523) |
| IUPAC Name |
|---|
| (5Z)-6-hydroperoxy-3,7-dimethylocta-1,5-dien-3-ol |
| Synonyms | Source |
|---|---|
| 6-hydroperoxylinalool | ChEBI |
| Lin-6-OOH | ChEBI |
| linalool-6-OOH | ChEBI |
| Citations |
|---|