EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H49N3O10S |
| Net Charge | 0 |
| Average Mass | 643.800 |
| Monoisotopic Mass | 643.31387 |
| SMILES | CCCCC/C=C\C[C@@H](O)C/C=C/C=C/[C@@H](SC[C@H](NC(=O)CC[C@H](N)C(=O)O)C(=O)NCC(=O)O)[C@@H](O)CCCC(=O)O |
| InChI | InChI=1S/C30H49N3O10S/c1-2-3-4-5-6-8-12-21(34)13-9-7-10-15-25(24(35)14-11-16-27(37)38)44-20-23(29(41)32-19-28(39)40)33-26(36)18-17-22(31)30(42)43/h6-10,15,21-25,34-35H,2-5,11-14,16-20,31H2,1H3,(H,32,41)(H,33,36)(H,37,38)(H,39,40)(H,42,43)/b8-6-,9-7+,15-10+/t21-,22+,23+,24+,25-/m1/s1 |
| InChIKey | GULYHEJDDHEDJT-GJUYVLLESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 11,12-dihydro-(12R)-hydroxyleukotriene C4 (CHEBI:134519) has functional parent leukotriene C4 (CHEBI:16978) |
| 11,12-dihydro-(12R)-hydroxyleukotriene C4 (CHEBI:134519) is a glutathione derivative (CHEBI:24337) |
| 11,12-dihydro-(12R)-hydroxyleukotriene C4 (CHEBI:134519) is a leukotriene (CHEBI:25029) |
| 11,12-dihydro-(12R)-hydroxyleukotriene C4 (CHEBI:134519) is a organic sulfide (CHEBI:16385) |
| 11,12-dihydro-(12R)-hydroxyleukotriene C4 (CHEBI:134519) is a secondary alcohol (CHEBI:35681) |
| 11,12-dihydro-(12R)-hydroxyleukotriene C4 (CHEBI:134519) is a tricarboxylic acid (CHEBI:27093) |
| 11,12-dihydro-(12R)-hydroxyleukotriene C4 (CHEBI:134519) is conjugate acid of 11,12-dihydro-(12R)-hydroxyleukotriene C4(2−) (CHEBI:133441) |
| Incoming Relation(s) |
| 11,12-dihydro-(12R)-hydroxyleukotriene C4(2−) (CHEBI:133441) is conjugate base of 11,12-dihydro-(12R)-hydroxyleukotriene C4 (CHEBI:134519) |
| IUPAC Name |
|---|
| L-γ-glutamyl-S-[(4S,5R,6E,8E,11R,13Z)-1-carboxy-4,11-dihydroxynonadeca-6,8,13-trien-5-yl]-L-cysteinylglycine |
| Synonyms | Source |
|---|---|
| 10,11-Dihydro-12R-hydroxy-leukotriene C4 | HMDB |
| 11,12-dihydro-(12R)-hydroxy-leukotriene C4 | ChEBI |
| 11,12-dihydro-(12R)-hydroxyl-LTC4 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0060155 | HMDB |