EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O6 |
| Net Charge | 0 |
| Average Mass | 368.470 |
| Monoisotopic Mass | 368.21989 |
| SMILES | O=C(O)CCC[C@H](O)/C=C\C=C\C=C\[C@H](O)C/C=C\CCCCC(O)O |
| InChI | InChI=1S/C20H32O6/c21-17(11-6-2-1-3-9-15-19(23)24)12-7-4-5-8-13-18(22)14-10-16-20(25)26/h2,4-8,12-13,17-19,21-24H,1,3,9-11,14-16H2,(H,25,26)/b5-4+,6-2-,12-7+,13-8-/t17-,18-/m1/s1 |
| InChIKey | ZZSBUQYGAPWEOJ-VFLUTPEKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 20,20-dihydroxyleukotriene B4 (CHEBI:134516) has functional parent leukotriene B4 (CHEBI:15647) |
| 20,20-dihydroxyleukotriene B4 (CHEBI:134516) is a aldehyde hydrate (CHEBI:63733) |
| 20,20-dihydroxyleukotriene B4 (CHEBI:134516) is a hydroxy polyunsaturated fatty acid (CHEBI:140345) |
| 20,20-dihydroxyleukotriene B4 (CHEBI:134516) is a leukotriene (CHEBI:25029) |
| 20,20-dihydroxyleukotriene B4 (CHEBI:134516) is a long-chain fatty acid (CHEBI:15904) |
| 20,20-dihydroxyleukotriene B4 (CHEBI:134516) is a secondary alcohol (CHEBI:35681) |
| 20,20-dihydroxyleukotriene B4 (CHEBI:134516) is conjugate acid of 20,20-dihydroxyleukotriene B4(1−) (CHEBI:133437) |
| Incoming Relation(s) |
| 20,20-dihydroxyleukotriene B4(1−) (CHEBI:133437) is conjugate base of 20,20-dihydroxyleukotriene B4 (CHEBI:134516) |
| IUPAC Name |
|---|
| (5S,6Z,8E,10E,12R,14Z)-5,12,20,20-tetrahydroxyicosa-6,8,10,14-tetraenoic acid |
| Synonyms | Source |
|---|---|
| 20-dihydroxyleukotriene B4 | ChEBI |
| 20-dihydroxy-LTB4 | ChEBI |
| 20-dihydroxy-leukotriene B4 | ChEBI |