EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H13N3O6P |
| Net Charge | -1 |
| Average Mass | 278.181 |
| Monoisotopic Mass | 278.05475 |
| SMILES | Nc1ccn(C[C@@H](CO)OCP(=O)([O-])O)c(=O)n1 |
| InChI | InChI=1S/C8H14N3O6P/c9-7-1-2-11(8(13)10-7)3-6(4-12)17-5-18(14,15)16/h1-2,6,12H,3-5H2,(H2,9,10,13)(H2,14,15,16)/p-1/t6-/m0/s1 |
| InChIKey | VWFCHDSQECPREK-LURJTMIESA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cidofovir(1−) (CHEBI:134514) is a organophosphonate oxoanion (CHEBI:59635) |
| cidofovir(1−) (CHEBI:134514) is conjugate acid of cidofovir(2−) (CHEBI:530615) |
| cidofovir(1−) (CHEBI:134514) is conjugate base of cidofovir anhydrous (CHEBI:3696) |
| Incoming Relation(s) |
| cidofovir anhydrous (CHEBI:3696) is conjugate acid of cidofovir(1−) (CHEBI:134514) |
| cidofovir(2−) (CHEBI:530615) is conjugate base of cidofovir(1−) (CHEBI:134514) |
| Synonym | Source |
|---|---|
| hydrogen ({[(2S)-1-(4-amino-2-oxopyrimidin-1(2H)-yl)-3-hydroxypropan-2-yl]oxy}methyl)phosphonate | ChEBI |
| UniProt Name | Source |
|---|---|
| cidofovir | UniProt |
| Citations |
|---|