EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O4 |
| Net Charge | 0 |
| Average Mass | 332.440 |
| Monoisotopic Mass | 332.19876 |
| SMILES | CC/C=C\C[C@H](O)/C=C/[C@H]1C=CC(=O)[C@@H]1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H28O4/c1-2-3-6-9-17(21)14-12-16-13-15-19(22)18(16)10-7-4-5-8-11-20(23)24/h3-4,6-7,12-18,21H,2,5,8-11H2,1H3,(H,23,24)/b6-3-,7-4-,14-12+/t16-,17-,18+/m0/s1 |
| InChIKey | KSIRMUMXJFWKAC-FHJHOUOTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Canis lupus familiaris (ncbitaxon:9615) | - | PubMed (10410384) |
| Roles Classification |
|---|
| Biological Role: | mammalian metabolite Any animal metabolite produced during a metabolic reaction in mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prostaglandin A3 (CHEBI:134510) has role mammalian metabolite (CHEBI:75768) |
| prostaglandin A3 (CHEBI:134510) is a prostaglandins A (CHEBI:26334) |
| prostaglandin A3 (CHEBI:134510) is a secondary allylic alcohol (CHEBI:134396) |
| prostaglandin A3 (CHEBI:134510) is conjugate acid of prostaglandin A3(1−) (CHEBI:133423) |
| Incoming Relation(s) |
| prostaglandin A3(1−) (CHEBI:133423) is conjugate base of prostaglandin A3 (CHEBI:134510) |
| IUPAC Name |
|---|
| (5Z,13E,15S,17Z)-15-hydroxy-9-oxoprosta-5,10,13,17-tetraen-1-oic acid |
| Synonym | Source |
|---|---|
| PGA3 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8937043 | Reaxys |
| Citations |
|---|