EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O2 |
| Net Charge | 0 |
| Average Mass | 168.236 |
| Monoisotopic Mass | 168.11503 |
| SMILES | [H][C@]1(C(=C)C)C=CC(C)(OO)CC1 |
| InChI | InChI=1S/C10H16O2/c1-8(2)9-4-6-10(3,12-11)7-5-9/h4,6,9,11H,1,5,7H2,2-3H3/t9-,10?/m0/s1 |
| InChIKey | LCOVCELWSKTKHX-RGURZIINSA-N |
| Roles Classification |
|---|
| Biological Roles: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. drug allergen Any drug which causes the onset of an allergic reaction. |
| Application: | drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4R)-limonene 1-hydroperoxide (CHEBI:134498) has role allergen (CHEBI:50904) |
| (4R)-limonene 1-hydroperoxide (CHEBI:134498) is a (4R)-limonene hydroperoxide (CHEBI:134497) |
| IUPAC Name |
|---|
| (4R)-1-methyl-4-(prop-1-en-2-yl)cyclohex-2-ene-1-peroxol |
| Synonyms | Source |
|---|---|
| (4R)-1-hydroperoxylimonene | ChEBI |
| (4R)-limonene-1-hydroperoxide | ChEBI |
| Lim-1-OOH | ChEBI |
| Citations |
|---|