EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H75N |
| Net Charge | 0 |
| Average Mass | 522.003 |
| Monoisotopic Mass | 521.58995 |
| SMILES | CCCCCCCCCCCCN(CCCCCCCCCCCC)CCCCCCCCCCCC |
| InChI | InChI=1S/C36H75N/c1-4-7-10-13-16-19-22-25-28-31-34-37(35-32-29-26-23-20-17-14-11-8-5-2)36-33-30-27-24-21-18-15-12-9-6-3/h4-36H2,1-3H3 |
| InChIKey | SWZDQOUHBYYPJD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | - | MetaboLights (MTBLS313) | |
| Mus musculus (ncbitaxon:10090) | - | MetaboLights (MTBLS313) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). ionophore A compound which can carry specific ions through membranes of cells or organelles. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tridodecylamine (CHEBI:134485) has role ionophore (CHEBI:24869) |
| tridodecylamine (CHEBI:134485) has role mouse metabolite (CHEBI:75771) |
| tridodecylamine (CHEBI:134485) has role rat metabolite (CHEBI:86264) |
| tridodecylamine (CHEBI:134485) is a tertiary amine (CHEBI:32876) |
| IUPAC Name |
|---|
| N,N-didodecyldodecan-1-amine |
| Synonyms | Source |
|---|---|
| Trilaurylamine | HMDB |
| N,N-Didodceyl-1-dodecanamine | HMDB |
| Tridodecyl amine | HMDB |
| Tri-n-dodecylamine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0037822 | HMDB |
| Citations |
|---|