EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H28O10 |
| Net Charge | 0 |
| Average Mass | 488.489 |
| Monoisotopic Mass | 488.16825 |
| SMILES | COc1cc(CCCO[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc2cc(-c3ccc4c(c3)OCO4)oc12 |
| InChI | InChI=1S/C25H28O10/c1-30-19-8-13(3-2-6-31-25-23(29)22(28)21(27)20(11-26)35-25)7-15-10-17(34-24(15)19)14-4-5-16-18(9-14)33-12-32-16/h4-5,7-10,20-23,25-29H,2-3,6,11-12H2,1H3/t20-,21-,22+,23-,25-/m1/s1 |
| InChIKey | RAMYDZNQLYKTGB-MXCHMSEPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Laetiporus sulphureus var. miniatus (ncbitaxon:447505) | - | PubMed (11253926) | |
| Mus musculus (ncbitaxon:10090) | |||
| - | MetaboLights (MTBLS313) | ||
| - | MetaboLights (MTBLS313) | ||
| Rattus norvegicus (ncbitaxon:10116) | |||
| - | MetaboLights (MTBLS313) | ||
| - | MetaboLights (MTBLS313) | ||
| Styrax japonica (ncbitaxon:59680) | bark (BTO:0001301) | PubMed (15577246) | Isolated from stem bark |
| Styrax macranthus (IPNI:826848-1) | seed (BTO:0001226) | PubMed (17335993) | |
| Styrax perkinsiae (ncbitaxon:153547) | seed (BTO:0001226) | PubMed (16206040) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| egonol β-D-glucoside (CHEBI:134480) has functional parent egonol (CHEBI:69558) |
| egonol β-D-glucoside (CHEBI:134480) has role fungal metabolite (CHEBI:76946) |
| egonol β-D-glucoside (CHEBI:134480) has role mouse metabolite (CHEBI:75771) |
| egonol β-D-glucoside (CHEBI:134480) has role plant metabolite (CHEBI:76924) |
| egonol β-D-glucoside (CHEBI:134480) has role rat metabolite (CHEBI:86264) |
| egonol β-D-glucoside (CHEBI:134480) is a 1-benzofurans (CHEBI:38830) |
| egonol β-D-glucoside (CHEBI:134480) is a aromatic ether (CHEBI:35618) |
| egonol β-D-glucoside (CHEBI:134480) is a benzodioxoles (CHEBI:38298) |
| egonol β-D-glucoside (CHEBI:134480) is a biaryl (CHEBI:64459) |
| egonol β-D-glucoside (CHEBI:134480) is a monosaccharide derivative (CHEBI:63367) |
| egonol β-D-glucoside (CHEBI:134480) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Names |
|---|
| 3-[2-(2H-1,3-benzodioxol-5-yl)-7-methoxy-1-benzofuran-5-yl]propyl β-D-glucopyranoside |
| egonol β-glucoside |
| egonol β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| Egonol glucoside | KNApSAcK |
| Manual Xrefs | Databases |
|---|---|
| C00031759 | KNApSAcK |
| HMDB0034280 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6550427 | Reaxys |
| CAS:77690-83-6 | HMDB |
| Citations |
|---|