EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H38O2 |
| Net Charge | 0 |
| Average Mass | 310.522 |
| Monoisotopic Mass | 310.28718 |
| SMILES | CCCCCC/C=C\CCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C20H38O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h7-8H,2-6,9-19H2,1H3,(H,21,22)/b8-7- |
| InChIKey | URXZXNYJPAJJOQ-FPLPWBNLSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Allophylus dregeanus (ncbitaxon:1237397) | seed (BTO:0001226) | PubMed (16382577) | |
| Allophylus natalensis (ncbitaxon:290912) | seed (BTO:0001226) | PubMed (16382577) | |
| Arabidopsis thaliana (ncbitaxon:3702) | seed (BTO:0001226) | DOI (10.1111/j.1439-0523.2007.01316.x) | |
| Mus musculus (ncbitaxon:10090) | - | MetaboLights (MTBLS313) | |
| Paullinia cupana var. sorbilis (ncbitaxon:392746) | seed (BTO:0001226) | PubMed (14506841) | |
| Rattus norvegicus (ncbitaxon:10116) | - | MetaboLights (MTBLS313) | |
| Tinospora crispa (ncbitaxon:285591) | whole plant (BTO:0001461) | PubMed (24969238) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (Z)-icos-13-enoic acid (CHEBI:134479) has role mouse metabolite (CHEBI:75771) |
| (Z)-icos-13-enoic acid (CHEBI:134479) has role plant metabolite (CHEBI:76924) |
| (Z)-icos-13-enoic acid (CHEBI:134479) has role rat metabolite (CHEBI:86264) |
| (Z)-icos-13-enoic acid (CHEBI:134479) is a icosenoic acid (CHEBI:23902) |
| IUPAC Name |
|---|
| (13Z)-icos-13-enoic acid |
| Synonyms | Source |
|---|---|
| (13Z)-eicos-13-enoic acid | ChEBI |
| 13Z-eicosenoic acid | LIPID MAPS |
| C20:1n-7 | LIPID MAPS |
| cis-13-Eicosenoic acid | HMDB |
| (Z)-13-icosenoic acid | ChEBI |
| (Z)-eicos-13-enoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0035159 | HMDB |
| LMFA01030367 | LIPID MAPS |
| Paullinic_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2452577 | Reaxys |
| CAS:17735-94-3 | HMDB |
| Citations |
|---|