EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H23N7O6 |
| Net Charge | 0 |
| Average Mass | 457.447 |
| Monoisotopic Mass | 457.17098 |
| SMILES | CN1C(CNc2ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)cc2)=CNc2nc(N)nc(=O)c21 |
| InChI | InChI=1S/C20H23N7O6/c1-27-12(9-23-16-15(27)18(31)26-20(21)25-16)8-22-11-4-2-10(3-5-11)17(30)24-13(19(32)33)6-7-14(28)29/h2-5,9,13,22H,6-8H2,1H3,(H,24,30)(H,28,29)(H,32,33)(H4,21,23,25,26,31)/t13-/m0/s1 |
| InChIKey | VWNDXSYYCICZGD-ZDUSSCGKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | - | MetaboLights (MTBLS313) | |
| Mus musculus (ncbitaxon:10090) | - | MetaboLights (MTBLS313) | |
| Homo sapiens (ncbitaxon:9606) | - | PubMed (405403) |
| Roles Classification |
|---|
| Biological Roles: | rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. water-soluble vitamin (role) Any vitamin that dissolves in water and readily absorbed into tissues for immediate use. Unlike the fat-soluble vitamins, they are not stored in the body and need to be replenished regularly in the diet and will rarely accumulate to toxic levels since they are quickly excreted from the body via urine. |
| Application: | nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-methyldihydrofolic acid (CHEBI:134470) has role human xenobiotic metabolite (CHEBI:76967) |
| 5-methyldihydrofolic acid (CHEBI:134470) has role mouse metabolite (CHEBI:75771) |
| 5-methyldihydrofolic acid (CHEBI:134470) has role rat metabolite (CHEBI:86264) |
| 5-methyldihydrofolic acid (CHEBI:134470) is a dihydrofolic acids (CHEBI:23743) |
| IUPAC Name |
|---|
| N-(4-{[(2-amino-5-methyl-4-oxo-1,4,5,8-tetrahydropteridin-6-yl)methyl]amino}benzoyl)-L-glutamic acid |
| Synonyms | Source |
|---|---|
| (2S)-2-[(4-{[(2-amino-5-methyl-4-oxo-1,4,5,8-tetrahydropteridin-6-yl)methyl]amino}phenyl)formamido]pentanedioic acid | HMDB |
| 5-Methyl-5,8-dihydrofolic acid | HMDB |
| 5-Methyldihydrofolate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0006486 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:59904-24-4 | ChemIDplus |
| Citations |
|---|