EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20N2O4S |
| Net Charge | 0 |
| Average Mass | 312.391 |
| Monoisotopic Mass | 312.11438 |
| SMILES | CSCC[C@H](NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C14H20N2O4S/c1-21-7-6-12(14(19)20)16-13(18)11(15)8-9-2-4-10(17)5-3-9/h2-5,11-12,17H,6-8,15H2,1H3,(H,16,18)(H,19,20)/t11-,12-/m0/s1 |
| InChIKey | KYPMKDGKAYQCHO-RYUDHWBXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | MetaboLights (MTBLS313) | |
| Rattus norvegicus (ncbitaxon:10116) | - | MetaboLights (MTBLS313) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tyr-Met (CHEBI:134468) has role mouse metabolite (CHEBI:75771) |
| Tyr-Met (CHEBI:134468) has role rat metabolite (CHEBI:86264) |
| Tyr-Met (CHEBI:134468) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-tyrosyl-L-methionine |
| Synonyms | Source |
|---|---|
| L-Tyr-L-Met | ChEBI |
| tyrosylmethionine | ChEBI |
| Tyrosyl-Methionine | HMDB |
| YM | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029111 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11062984 | Reaxys |