EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O5 |
| Net Charge | 0 |
| Average Mass | 350.455 |
| Monoisotopic Mass | 350.20932 |
| SMILES | O=C(O)CCC[C@H](O)/C=C\C=C\C=C\C(=O)C/C=C\CCCCCO |
| InChI | InChI=1S/C20H30O5/c21-17-10-6-2-1-3-7-12-18(22)13-8-4-5-9-14-19(23)15-11-16-20(24)25/h3-5,7-9,13-14,19,21,23H,1-2,6,10-12,15-17H2,(H,24,25)/b5-4+,7-3-,13-8+,14-9-/t19-/m1/s1 |
| InChIKey | CZWPUWRHQBAXJS-RBQYXHKQSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-oxo-20-hydroxyleukotriene B4 (CHEBI:134456) has functional parent leukotriene B4 (CHEBI:15647) |
| 12-oxo-20-hydroxyleukotriene B4 (CHEBI:134456) is a hydroxy polyunsaturated fatty acid (CHEBI:140345) |
| 12-oxo-20-hydroxyleukotriene B4 (CHEBI:134456) is a leukotriene (CHEBI:25029) |
| 12-oxo-20-hydroxyleukotriene B4 (CHEBI:134456) is a long-chain fatty acid (CHEBI:15904) |
| 12-oxo-20-hydroxyleukotriene B4 (CHEBI:134456) is a oxo fatty acid (CHEBI:59644) |
| 12-oxo-20-hydroxyleukotriene B4 (CHEBI:134456) is a primary alcohol (CHEBI:15734) |
| 12-oxo-20-hydroxyleukotriene B4 (CHEBI:134456) is a secondary alcohol (CHEBI:35681) |
| 12-oxo-20-hydroxyleukotriene B4 (CHEBI:134456) is conjugate acid of 12-oxo-20-hydroxyleukotriene B4(1−) (CHEBI:133346) |
| Incoming Relation(s) |
| 12-oxo-20-hydroxyleukotriene B4(1−) (CHEBI:133346) is conjugate base of 12-oxo-20-hydroxyleukotriene B4 (CHEBI:134456) |
| IUPAC Name |
|---|
| (5S,6Z,8E,10E,14Z)-5,20-dihydroxy-12-oxoicosa-6,8,10,14-tetraenoic acid |
| Synonyms | Source |
|---|---|
| 12-oxo-20-hydroxy-leukotriene B4 | ChEBI |
| 12-oxo-20-hydroxy-LTB4 | ChEBI |