EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O7 |
| Net Charge | 0 |
| Average Mass | 386.485 |
| Monoisotopic Mass | 386.23045 |
| SMILES | O=C(O)CCC[C@H](O)/C=C\C=C\CC[C@H](O)C/C=C\CCCCC(O)(O)O |
| InChI | InChI=1S/C20H34O7/c21-17(11-6-2-1-5-9-16-20(25,26)27)12-7-3-4-8-13-18(22)14-10-15-19(23)24/h2-4,6,8,13,17-18,21-22,25-27H,1,5,7,9-12,14-16H2,(H,23,24)/b4-3+,6-2-,13-8-/t17-,18-/m1/s1 |
| InChIKey | LSVHZFZMMXHHBS-YEFXUWHISA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 10,11-dihydro-20,20,20-trihydroxyleukotriene B4 (CHEBI:134442) has functional parent leukotriene B4 (CHEBI:15647) |
| 10,11-dihydro-20,20,20-trihydroxyleukotriene B4 (CHEBI:134442) is a hydroxy polyunsaturated fatty acid (CHEBI:140345) |
| 10,11-dihydro-20,20,20-trihydroxyleukotriene B4 (CHEBI:134442) is a leukotriene (CHEBI:25029) |
| 10,11-dihydro-20,20,20-trihydroxyleukotriene B4 (CHEBI:134442) is a long-chain fatty acid (CHEBI:15904) |
| 10,11-dihydro-20,20,20-trihydroxyleukotriene B4 (CHEBI:134442) is conjugate acid of 10,11-dihydro-20,20,20-trihydroxyleukotriene B4(1−) (CHEBI:133323) |
| Incoming Relation(s) |
| 10,11-dihydro-20,20,20-trihydroxyleukotriene B4(1−) (CHEBI:133323) is conjugate base of 10,11-dihydro-20,20,20-trihydroxyleukotriene B4 (CHEBI:134442) |
| IUPAC Name |
|---|
| (5S,6Z,8E,12S,14Z)-5,12,20,20,20-pentahydroxyicosa-6,8,14-trienoic acid |
| Synonyms | Source |
|---|---|
| 10,11-dihydro-20,20,20-trihydroxy-LTB4 | ChEBI |
| 10,11-dihydro-20-trihydroxy-leukotriene B4 | HMDB |
| 10,11-dihydro-20-trihydroxy-LTB4 | ChEBI |
| 20,20,20-trihydroxy-10,11-dihydroleukotriene B4 | ChEBI |
| 20,20,20-trihydroxy-10,11-dihydro-LTB4 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0012503 | HMDB |