EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O4 |
| Net Charge | 0 |
| Average Mass | 336.472 |
| Monoisotopic Mass | 336.23006 |
| SMILES | CCCCC/C=C\CC(=O)CC/C=C/C=C\[C@@H](O)CCCC(=O)O |
| InChI | InChI=1S/C20H32O4/c1-2-3-4-5-6-9-13-18(21)14-10-7-8-11-15-19(22)16-12-17-20(23)24/h6-9,11,15,19,22H,2-5,10,12-14,16-17H2,1H3,(H,23,24)/b8-7+,9-6-,15-11-/t19-/m1/s1 |
| InChIKey | AHHXLFNPCWCNQF-WWIKSGRJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 10,11-dihydro-12-oxoleukotriene B4 (CHEBI:134417) has functional parent leukotriene B4 (CHEBI:15647) |
| 10,11-dihydro-12-oxoleukotriene B4 (CHEBI:134417) is a hydroxy polyunsaturated fatty acid (CHEBI:140345) |
| 10,11-dihydro-12-oxoleukotriene B4 (CHEBI:134417) is a long-chain fatty acid (CHEBI:15904) |
| 10,11-dihydro-12-oxoleukotriene B4 (CHEBI:134417) is a nonclassic icosanoid (CHEBI:61703) |
| 10,11-dihydro-12-oxoleukotriene B4 (CHEBI:134417) is a oxo fatty acid (CHEBI:59644) |
| 10,11-dihydro-12-oxoleukotriene B4 (CHEBI:134417) is conjugate acid of 10,11-dihydro-12-oxoleukotriene B4(1−) (CHEBI:133319) |
| Incoming Relation(s) |
| 10,11-dihydro-12-oxoleukotriene B4(1−) (CHEBI:133319) is conjugate base of 10,11-dihydro-12-oxoleukotriene B4 (CHEBI:134417) |
| IUPAC Name |
|---|
| (5S,6Z,8E,14Z)-5-hydroxy-12-oxoicosa-6,8,14-trienoic acid |
| Synonym | Source |
|---|---|
| 12-oxo-10,11-dihydroleukotriene B4 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7858630 | Reaxys |