EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C79H152N10O13S |
| Net Charge | 0 |
| Average Mass | 1482.209 |
| Monoisotopic Mass | 1481.12611 |
| SMILES | CCCCCCCCCCCCCCCC(=O)OCC(CSC[C@H](NC(=O)CCCCCCCCCCCCC)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCCN)C(=O)O)OC(=O)CCCCCCCCCCCCCCC |
| InChI | InChI=1S/C79H152N10O13S/c1-4-7-10-13-16-19-22-24-27-30-33-36-39-54-72(92)101-61-64(102-73(93)55-40-37-34-31-28-25-23-20-17-14-11-8-5-2)62-103-63-70(84-71(91)53-38-35-32-29-26-21-18-15-12-9-6-3)78(98)89-69(60-90)77(97)87-66(50-42-46-57-81)75(95)85-65(49-41-45-56-80)74(94)86-67(51-43-47-58-82)76(96)88-68(79(99)100)52-44-48-59-83/h64-70,90H,4-63,80-83H2,1-3H3,(H,84,91)(H,85,95)(H,86,94)(H,87,97)(H,88,96)(H,89,98)(H,99,100)/t64?,65-,66-,67-,68-,69-,70-/m0/s1 |
| InChIKey | ACYXXCRNFRQHBB-RXUNMRDHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | Toll-like receptor 2 agonist An agonist that selectively binds to and activates the Toll-like receptor 2 (TLR 2, TLR-2) protein. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-palmitoyl-S-[2,3-bis(palmitoyloxy)propyl]-Cys-Ser-Lys-Lys-Lys-Lys (CHEBI:134411) has role antineoplastic agent (CHEBI:35610) |
| N-palmitoyl-S-[2,3-bis(palmitoyloxy)propyl]-Cys-Ser-Lys-Lys-Lys-Lys (CHEBI:134411) has role neuroprotective agent (CHEBI:63726) |
| N-palmitoyl-S-[2,3-bis(palmitoyloxy)propyl]-Cys-Ser-Lys-Lys-Lys-Lys (CHEBI:134411) has role Toll-like receptor 2 agonist (CHEBI:77161) |
| N-palmitoyl-S-[2,3-bis(palmitoyloxy)propyl]-Cys-Ser-Lys-Lys-Lys-Lys (CHEBI:134411) is a lipopeptide antibiotic (CHEBI:25061) |
| N-palmitoyl-S-[2,3-bis(palmitoyloxy)propyl]-Cys-Ser-Lys-Lys-Lys-Lys (CHEBI:134411) is a pentapeptide (CHEBI:48545) |
| N-palmitoyl-S-[2,3-bis(palmitoyloxy)propyl]-Cys-Ser-Lys-Lys-Lys-Lys (CHEBI:134411) is a triacyl lipopeptide (CHEBI:60192) |
| IUPAC Name |
|---|
| S-[2,3-bis(hexadecanoyloxy)propyl]-N-tetradecanoyl-L-cysteinyl-L-seryl-L-lysyl-L-lysyl-L-lysyl-L-lysine |
| Synonyms | Source |
|---|---|
| N-hexadecanoyl-S-[2,3-bis(hexadecanoyloxy)propyl]-Cys-Ser-Lys-Lys-Lys-Lys | ChEBI |
| N-Palmitoyl-S-(2,3-bis(palmitoyloxy)propyl)cysteinyl-seryl-lysyl-lysyl-lysyl-lysine | ChemIDplus |
| Pam3CSK4 | ChEBI |
| Pam(3)-cys-ser-(lys)(4) | ChemIDplus |
| Tripalmitoyl-cysteinyl-seryl-lysine(4) | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:112208-00-1 | ChemIDplus |
| Citations |
|---|