EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H21NO3S |
| Net Charge | 0 |
| Average Mass | 247.360 |
| Monoisotopic Mass | 247.12421 |
| SMILES | CCCCCCCC(=O)SC[C@H](N)C(=O)O |
| InChI | InChI=1S/C11H21NO3S/c1-2-3-4-5-6-7-10(13)16-8-9(12)11(14)15/h9H,2-8,12H2,1H3,(H,14,15)/t9-/m0/s1 |
| InChIKey | VPHGZJNWNJRHQO-VIFPVBQESA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-octanoyl-L-cysteine (CHEBI:134410) has functional parent octanoic acid (CHEBI:28837) |
| S-octanoyl-L-cysteine (CHEBI:134410) is a L-cysteine derivative (CHEBI:83824) |
| S-octanoyl-L-cysteine (CHEBI:134410) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| S-octanoyl-L-cysteine (CHEBI:134410) is a thioester (CHEBI:51277) |
| IUPAC Name |
|---|
| S-octanoyl-L-cysteine |
| Synonym | Source |
|---|---|
| S-octanoylcysteine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8846221 | Reaxys |