EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12N2O3S |
| Net Charge | 0 |
| Average Mass | 240.284 |
| Monoisotopic Mass | 240.05686 |
| SMILES | Nc1ccccc1C(=O)SC[C@H](N)C(=O)O |
| InChI | InChI=1S/C10H12N2O3S/c11-7-4-2-1-3-6(7)10(15)16-5-8(12)9(13)14/h1-4,8H,5,11-12H2,(H,13,14)/t8-/m0/s1 |
| InChIKey | BYVARANRNFXKPH-QMMMGPOBSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-anthraniloyl-L-cysteine (CHEBI:134405) has functional parent anthranilic acid (CHEBI:30754) |
| S-anthraniloyl-L-cysteine (CHEBI:134405) is a L-cysteine derivative (CHEBI:83824) |
| S-anthraniloyl-L-cysteine (CHEBI:134405) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| S-anthraniloyl-L-cysteine (CHEBI:134405) is a thioester (CHEBI:51277) |
| Incoming Relation(s) |
| S-anthraniloyl-L-cysteine residue (CHEBI:133304) is substituent group from S-anthraniloyl-L-cysteine (CHEBI:134405) |
| IUPAC Name |
|---|
| S-(2-aminobenzoyl)-L-cysteine |
| Synonym | Source |
|---|---|
| S-anthraniloylcysteine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CSJ | PDBeChem |