EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22O3 |
| Net Charge | 0 |
| Average Mass | 298.382 |
| Monoisotopic Mass | 298.15689 |
| SMILES | CC(C)=CCC/C(C)=C/Cc1c(O)ccc2ccc(=O)oc12 |
| InChI | InChI=1S/C19H22O3/c1-13(2)5-4-6-14(3)7-10-16-17(20)11-8-15-9-12-18(21)22-19(15)16/h5,7-9,11-12,20H,4,6,10H2,1-3H3/b14-7+ |
| InChIKey | QPMKRRUDQIKGNH-VGOFMYFVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Paramignya trimera (ncbitaxon:1553915) | stem (BTO:0001300) | PubMed (28245363) | |
| Luvunga sarmentosa (IPNI:774221-1) | leaf (BTO:0000713) | PubMed (12127593) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-geranylumbelliferone (CHEBI:134358) has functional parent umbelliferone (CHEBI:27510) |
| 8-geranylumbelliferone (CHEBI:134358) has role plant metabolite (CHEBI:76924) |
| 8-geranylumbelliferone (CHEBI:134358) is a hydroxycoumarin (CHEBI:37912) |
| 8-geranylumbelliferone (CHEBI:134358) is a monoterpenoid (CHEBI:25409) |
| IUPAC Name |
|---|
| 8-[(2E)-3,7-dimethylocta-2,6-dien-1-yl]-7-hydroxy-2H-1-benzopyran-2-one |
| Synonym | Source |
|---|---|
| 8-Geranyl-7-hydroxycoumarin | KNApSAcK |
| UniProt Name | Source |
|---|---|
| 8-geranylumbelliferone | UniProt |
| Citations |
|---|