EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O4 |
| Net Charge | 0 |
| Average Mass | 332.440 |
| Monoisotopic Mass | 332.19876 |
| SMILES | CC(C)=CCc1c(O)c(CC=C(C)C)c(O)c(C(=O)C(C)C)c1O |
| InChI | InChI=1S/C20H28O4/c1-11(2)7-9-14-18(22)15(10-8-12(3)4)20(24)16(19(14)23)17(21)13(5)6/h7-8,13,22-24H,9-10H2,1-6H3 |
| InChIKey | KKFIZYKKQLWBKH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| deoxycohumulone (CHEBI:134353) has role agrochemical (CHEBI:33286) |
| deoxycohumulone (CHEBI:134353) has role insecticide (CHEBI:24852) |
| deoxycohumulone (CHEBI:134353) is a 2-acyl-4,6-diprenylphloroglucinol (CHEBI:136850) |
| IUPAC Name |
|---|
| 2-methyl-1-[2,4,6-trihydroxy-3,5-bis(3-methylbut-2-en-1-yl)phenyl]propan-1-one |
| Synonyms | Source |
|---|---|
| diprenylphlorisobutyrophenone | MetaCyc |
| 3,5-diprenylphlorisobutyrophenone | ChEBI |
| 3,5-Bis(3-methyl-2-butenyl)phlorisobutyrophenone | HMDB |
| UniProt Name | Source |
|---|---|
| deoxycohumulone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| HMDB0036623 | HMDB |
| CPD-7107 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2059082 | Reaxys |
| CAS:5880-42-2 | HMDB |
| Citations |
|---|