EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28O4R |
| Net Charge | -1 |
| Average Mass (excl. R groups) | 356.456 |
| Monoisotopic Mass (excl. R groups) | 356.19876 |
| SMILES | *C(=O)C1=C([O-])C(CC=C(C)C)=C(O)C(CC=C(C)C)(CC=C(C)C)C1=O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-bitter acid(1−) (CHEBI:134348) is a organic anion (CHEBI:25696) |
| β-bitter acid(1−) (CHEBI:134348) is conjugate base of β-bitter acid (CHEBI:136848) |
| Incoming Relation(s) |
| adlupulone(1−) (CHEBI:134352) is a β-bitter acid(1−) (CHEBI:134348) |
| colupulone(1−) (CHEBI:134349) is a β-bitter acid(1−) (CHEBI:134348) |
| lupulone(1−) (CHEBI:134343) is a β-bitter acid(1−) (CHEBI:134348) |
| β-bitter acid (CHEBI:136848) is conjugate acid of β-bitter acid(1−) (CHEBI:134348) |
| Synonyms | Source |
|---|---|
| β-bitter acid anion | ChEBI |
| 2-acyl-4,6,6-triprenylphloroglucinol(1−) | ChEBI |
| UniProt Name | Source |
|---|---|
| a 2-acyl-4,6,6-triprenylphloroglucinol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| BETA-ACIDS | MetaCyc |